C13H10Cl2N2O2 — CID 106548770
2-[2-(3,4-dichlorophenyl)-2-oxoethyl]-5-methylpyridazin-3-one (PubChem CID 106548770) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-2-oxoethyl]-5-methylpyridazin-3-one.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-2-oxoethyl]-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 106548770 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-2-oxoethyl]-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CC(=O)c2ccc(Cl)c(Cl)c2)c(=O)c1 |
| InChI | InChI=1S/C13H10Cl2N2O2/c1-8-4-13(19)17(16-6-8)7-12(18)9-2-3-10(14)11(15)5-9/h2-6H,7H2,1H3 |
| InChIKey | SDLHNZURTVPQGX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |