About 1-pyridin-3-yl-1,4-diazepane
1-pyridin-3-yl-1,4-diazepane (PubChem CID 10654891) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-pyridin-3-yl-1,4-diazepane |
| PubChem CID | 10654891 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-pyridin-3-yl-1,4-diazepane |
| SMILES | c1cncc(N2CCCNCC2)c1 |
| InChI | InChI=1S/C10H15N3/c1-3-10(9-12-4-1)13-7-2-5-11-6-8-13/h1,3-4,9,11H,2,5-8H2 |
| InChIKey | JBOVXXZNZSULJJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyridin-3-yl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-yl-1,4-diazepane?
The IUPAC name of 1-pyridin-3-yl-1,4-diazepane (CID 10654891) is 1-pyridin-3-yl-1,4-diazepane.
What is the SMILES notation for 1-pyridin-3-yl-1,4-diazepane?
The canonical SMILES for 1-pyridin-3-yl-1,4-diazepane is c1cncc(N2CCCNCC2)c1.
What is the InChIKey of 1-pyridin-3-yl-1,4-diazepane?
The InChIKey is JBOVXXZNZSULJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-3-10(9-12-4-1)13-7-2-5-11-6-8-13/h1,3-4,9,11H,2,5-8H2.
What are the key properties of 1-pyridin-3-yl-1,4-diazepane?
1-pyridin-3-yl-1,4-diazepane has a molecular weight of 177.25 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-yl-1,4-diazepane is sourced from PubChem (CID 10654891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).