C10H16N2OS — CID 106549204
2-(2,2-dimethyl-3-sulfanylpropyl)-5-methylpyridazin-3-one (PubChem CID 106549204) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-sulfanylpropyl)-5-methylpyridazin-3-one.
| Compound Name | 2-(2,2-dimethyl-3-sulfanylpropyl)-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 106549204 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(2,2-dimethyl-3-sulfanylpropyl)-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CC(C)(C)CS)c(=O)c1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-4-9(13)12(11-5-8)6-10(2,3)7-14/h4-5,14H,6-7H2,1-3H3 |
| InChIKey | PPGISYOKQDWOEG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|