About 3-hydroxypyrazolo[5,4-c]quinoline
3-hydroxypyrazolo[5,4-c]quinoline (PubChem CID 10655111) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 3-hydroxypyrazolo[5,4-c]quinoline.
Molecular Properties
| Compound Name | 3-hydroxypyrazolo[5,4-c]quinoline |
| PubChem CID | 10655111 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-hydroxypyrazolo[5,4-c]quinoline |
| SMILES | On1ncc2c3ccccc3ncc21 |
| InChI | InChI=1S/C10H7N3O/c14-13-10-6-11-9-4-2-1-3-7(9)8(10)5-12-13/h1-6,14H |
| InChIKey | IXQJOCDIPDIZNW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypyrazolo[5,4-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypyrazolo[5,4-c]quinoline?
The IUPAC name of 3-hydroxypyrazolo[5,4-c]quinoline (CID 10655111) is 3-hydroxypyrazolo[5,4-c]quinoline.
What is the SMILES notation for 3-hydroxypyrazolo[5,4-c]quinoline?
The canonical SMILES for 3-hydroxypyrazolo[5,4-c]quinoline is On1ncc2c3ccccc3ncc21.
What is the InChIKey of 3-hydroxypyrazolo[5,4-c]quinoline?
The InChIKey is IXQJOCDIPDIZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c14-13-10-6-11-9-4-2-1-3-7(9)8(10)5-12-13/h1-6,14H.
What are the key properties of 3-hydroxypyrazolo[5,4-c]quinoline?
3-hydroxypyrazolo[5,4-c]quinoline has a molecular weight of 185.19 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypyrazolo[5,4-c]quinoline is sourced from PubChem (CID 10655111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).