C11H15ClN4O — CID 106551219
6-chloro-N-[2-[cyclopropyl(methyl)amino]ethyl]pyrazine-2-carboxamide (PubChem CID 106551219) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 6-chloro-N-[2-[cyclopropyl(methyl)amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-[2-[cyclopropyl(methyl)amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106551219 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-chloro-N-[2-[cyclopropyl(methyl)amino]ethyl]pyrazine-2-carboxamide |
| SMILES | CN(CCNC(=O)c1cncc(Cl)n1)C1CC1 |
| InChI | InChI=1S/C11H15ClN4O/c1-16(8-2-3-8)5-4-14-11(17)9-6-13-7-10(12)15-9/h6-8H,2-5H2,1H3,(H,14,17) |
| InChIKey | NDEWLMIBXARRJL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |