C10H14ClN3O3 — CID 106551616
6-chloro-N-(3-hydroxy-4-methoxybutyl)pyrazine-2-carboxamide (PubChem CID 106551616) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 6-chloro-N-(3-hydroxy-4-methoxybutyl)pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-(3-hydroxy-4-methoxybutyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106551616 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 6-chloro-N-(3-hydroxy-4-methoxybutyl)pyrazine-2-carboxamide |
| SMILES | COCC(O)CCNC(=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3O3/c1-17-6-7(15)2-3-13-10(16)8-4-12-5-9(11)14-8/h4-5,7,15H,2-3,6H2,1H3,(H,13,16) |
| InChIKey | DPRFDCQXGPUWDK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |