About 2-butyl-1-benzothiophene
2-butyl-1-benzothiophene (PubChem CID 10655312) has the molecular formula C12H14S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-butyl-1-benzothiophene.
Molecular Properties
| Compound Name | 2-butyl-1-benzothiophene |
| PubChem CID | 10655312 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-butyl-1-benzothiophene |
| SMILES | CCCCc1cc2ccccc2s1 |
| InChI | InChI=1S/C12H14S/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | YDANFNUATFWKJU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-benzothiophene?
The IUPAC name of 2-butyl-1-benzothiophene (CID 10655312) is 2-butyl-1-benzothiophene.
What is the SMILES notation for 2-butyl-1-benzothiophene?
The canonical SMILES for 2-butyl-1-benzothiophene is CCCCc1cc2ccccc2s1.
What is the InChIKey of 2-butyl-1-benzothiophene?
The InChIKey is YDANFNUATFWKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14S/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of 2-butyl-1-benzothiophene?
2-butyl-1-benzothiophene has a molecular weight of 190.31 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-benzothiophene is sourced from PubChem (CID 10655312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).