About N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine
N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 106553234) has the molecular formula C15H28N4
and a molecular weight of 264.42 g/mol. Its IUPAC name is N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine |
| PubChem CID | 106553234 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CCc1cn(C2CCCC2)c(N(C)CCCNC)n1 |
| InChI | InChI=1S/C15H28N4/c1-4-13-12-19(14-8-5-6-9-14)15(17-13)18(3)11-7-10-16-2/h12,14,16H,4-11H2,1-3H3 |
| InChIKey | FLSJWBZVHOPXQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine?
The IUPAC name of N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine (CID 106553234) is N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine?
The canonical SMILES for N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine is CCc1cn(C2CCCC2)c(N(C)CCCNC)n1.
What is the InChIKey of N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine?
The InChIKey is FLSJWBZVHOPXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4/c1-4-13-12-19(14-8-5-6-9-14)15(17-13)18(3)11-7-10-16-2/h12,14,16H,4-11H2,1-3H3.
What are the key properties of N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine?
N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine has a molecular weight of 264.42 g/mol, XLogP of 2.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyclopentyl-4-ethylimidazol-2-yl)-N,N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 106553234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).