About 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine
1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine (PubChem CID 106553574) has the molecular formula C17H26N4
and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine |
| PubChem CID | 106553574 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine |
| SMILES | Cc1cn(-c2ccccc2)c(N(C)CCC(N)C(C)C)n1 |
| InChI | InChI=1S/C17H26N4/c1-13(2)16(18)10-11-20(4)17-19-14(3)12-21(17)15-8-6-5-7-9-15/h5-9,12-13,16H,10-11,18H2,1-4H3 |
| InChIKey | QCEPXQBJCZBDBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine?
The IUPAC name of 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine (CID 106553574) is 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine.
What is the SMILES notation for 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine?
The canonical SMILES for 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine is Cc1cn(-c2ccccc2)c(N(C)CCC(N)C(C)C)n1.
What is the InChIKey of 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine?
The InChIKey is QCEPXQBJCZBDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4/c1-13(2)16(18)10-11-20(4)17-19-14(3)12-21(17)15-8-6-5-7-9-15/h5-9,12-13,16H,10-11,18H2,1-4H3.
What are the key properties of 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine?
1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine has a molecular weight of 286.42 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-dimethyl-1-N-(4-methyl-1-phenylimidazol-2-yl)pentane-1,3-diamine is sourced from PubChem (CID 106553574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).