C12H16O2 — CID 10655383
(1S,2S,3R,6R,8R,10S)-2-methoxytetracyclo[6.3.0.01,3.02,6]undec-4-en-10-ol (PubChem CID 10655383) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,2S,3R,6R,8R,10S)-2-methoxytetracyclo[6.3.0.01,3.02,6]undec-4-en-10-ol.
| Compound Name | (1S,2S,3R,6R,8R,10S)-2-methoxytetracyclo[6.3.0.01,3.02,6]undec-4-en-10-ol |
|---|---|
| PubChem CID | 10655383 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1S,2S,3R,6R,8R,10S)-2-methoxytetracyclo[6.3.0.01,3.02,6]undec-4-en-10-ol |
| SMILES | CO[C@]12[C@@H]3C=C[C@H]1C[C@@H]1C[C@H](O)C[C@]132 |
| InChI | InChI=1S/C12H16O2/c1-14-12-7-2-3-10(12)11(12)6-9(13)5-8(11)4-7/h2-3,7-10,13H,4-6H2,1H3/t7-,8+,9-,10+,11-,12-/m0/s1 |
| InChIKey | GHVSBDCYZGTSPI-IWTNGPMKSA-N |
| XLogP | 1.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|