C7H14N4 — CID 106553953
N'-ethyl-N'-(1H-imidazol-2-yl)ethane-1,2-diamine (PubChem CID 106553953) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is N'-ethyl-N'-(1H-imidazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(1H-imidazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106553953 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | N'-ethyl-N'-(1H-imidazol-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CCN)c1ncc[nH]1 |
| InChI | InChI=1S/C7H14N4/c1-2-11(6-3-8)7-9-4-5-10-7/h4-5H,2-3,6,8H2,1H3,(H,9,10) |
| InChIKey | LPUJFVLWWPJIJK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |