C11H15NO2 — CID 10655413
(E,2S,3S)-2-amino-5-phenylpent-4-ene-1,3-diol (PubChem CID 10655413) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (E,2S,3S)-2-amino-5-phenylpent-4-ene-1,3-diol.
| Compound Name | (E,2S,3S)-2-amino-5-phenylpent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 10655413 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (E,2S,3S)-2-amino-5-phenylpent-4-ene-1,3-diol |
| SMILES | N[C@@H](CO)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c12-10(8-13)11(14)7-6-9-4-2-1-3-5-9/h1-7,10-11,13-14H,8,12H2/b7-6+/t10-,11-/m0/s1 |
| InChIKey | KAOAFWORMXLRDR-JYLGIWJRSA-N |
| XLogP | 0.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |