C9H17N3O — CID 106554838
N-(2-methoxyethyl)-1-propan-2-ylimidazol-2-amine (PubChem CID 106554838) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-propan-2-ylimidazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-1-propan-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 106554838 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-(2-methoxyethyl)-1-propan-2-ylimidazol-2-amine |
| SMILES | COCCNc1nccn1C(C)C |
| InChI | InChI=1S/C9H17N3O/c1-8(2)12-6-4-10-9(12)11-5-7-13-3/h4,6,8H,5,7H2,1-3H3,(H,10,11) |
| InChIKey | PRRHFONITRTCSS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|