C11H16O3 — CID 10655495
(3aR,7aR)-7a-[[(2R)-oxiran-2-yl]methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 10655495) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3aR,7aR)-7a-[[(2R)-oxiran-2-yl]methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aR,7aR)-7a-[[(2R)-oxiran-2-yl]methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10655495 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3aR,7aR)-7a-[[(2R)-oxiran-2-yl]methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | O=C1OC[C@@H]2CCCC[C@]12C[C@@H]1CO1 |
| InChI | InChI=1S/C11H16O3/c12-10-11(5-9-7-13-9)4-2-1-3-8(11)6-14-10/h8-9H,1-7H2/t8-,9+,11+/m0/s1 |
| InChIKey | QKFKAKWMRPGMNC-IQJOONFLSA-N |
| XLogP | 1.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|