C10H15NO3 — CID 10655531
tert-butyl (1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 10655531) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is tert-butyl (1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-ene-3-carboxylate.
| Compound Name | tert-butyl (1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
|---|---|
| PubChem CID | 10655531 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | tert-butyl (1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1O[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C10H15NO3/c1-10(2,3)13-9(12)11-7-4-5-8(6-7)14-11/h4-5,7-8H,6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | JKCMHTNELDNMNY-JGVFFNPUSA-N |
| XLogP | 1.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|