C11H20O3 — CID 10655652
(2R,4S)-6-methylidenedec-9-ene-1,2,4-triol (PubChem CID 10655652) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2R,4S)-6-methylidenedec-9-ene-1,2,4-triol.
| Compound Name | (2R,4S)-6-methylidenedec-9-ene-1,2,4-triol |
|---|---|
| PubChem CID | 10655652 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2R,4S)-6-methylidenedec-9-ene-1,2,4-triol |
| SMILES | C=CCCC(=C)C[C@H](O)C[C@@H](O)CO |
| InChI | InChI=1S/C11H20O3/c1-3-4-5-9(2)6-10(13)7-11(14)8-12/h3,10-14H,1-2,4-8H2/t10-,11+/m0/s1 |
| InChIKey | BNKWCYVQEQFNMF-WDEREUQCSA-N |
| XLogP | 1.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|