About trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one
trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one (PubChem CID 10655653) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one |
| PubChem CID | 10655653 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one |
| SMILES | CO[C@@]1(C)C(=O)CC[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-10(2,3)14-9-7-6-8(12)11(9,4)13-5/h9H,6-7H2,1-5H3/t9-,11-/m0/s1 |
| InChIKey | FKNBHUVOGXBOTM-ONGXEEELSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one?
The IUPAC name of trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one (CID 10655653) is trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one.
What is the SMILES notation for trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one?
The canonical SMILES for trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one is CO[C@@]1(C)C(=O)CC[C@@H]1OC(C)(C)C.
What is the InChIKey of trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one?
The InChIKey is FKNBHUVOGXBOTM-ONGXEEELSA-N. The full InChI is InChI=1S/C11H20O3/c1-10(2,3)14-9-7-6-8(12)11(9,4)13-5/h9H,6-7H2,1-5H3/t9-,11-/m0/s1.
What are the key properties of trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one?
trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one has a molecular weight of 200.28 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,3S)-2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]cyclopentan-1-one is sourced from PubChem (CID 10655653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).