C10H8Cl3N3 — CID 106556588
1-methyl-N-(2,4,5-trichlorophenyl)imidazol-2-amine (PubChem CID 106556588) has the molecular formula C10H8Cl3N3 and a molecular weight of 276.55 g/mol. Its IUPAC name is 1-methyl-N-(2,4,5-trichlorophenyl)imidazol-2-amine.
| Compound Name | 1-methyl-N-(2,4,5-trichlorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106556588 |
| Molecular Formula | C10H8Cl3N3 |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 1-methyl-N-(2,4,5-trichlorophenyl)imidazol-2-amine |
| SMILES | Cn1ccnc1Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl3N3/c1-16-3-2-14-10(16)15-9-5-7(12)6(11)4-8(9)13/h2-5H,1H3,(H,14,15) |
| InChIKey | IXURORCGSWTSHM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|