C8H16N2 — CID 10655660
4-propyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 10655660) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-propyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 4-propyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 10655660 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-propyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CCCC1CCN=C(N)C1 |
| InChI | InChI=1S/C8H16N2/c1-2-3-7-4-5-10-8(9)6-7/h7H,2-6H2,1H3,(H2,9,10) |
| InChIKey | MEFVVPMWEUFYGI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |