About (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane
(2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane (PubChem CID 10655668) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane.
Molecular Properties
| Compound Name | (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane |
| PubChem CID | 10655668 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane |
| SMILES | C/C=C1\OCCSC1(CC)CCC |
| InChI | InChI=1S/C11H20OS/c1-4-7-11(6-3)10(5-2)12-8-9-13-11/h5H,4,6-9H2,1-3H3/b10-5- |
| InChIKey | BCNIWDRPCMYUMN-YHYXMXQVSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane?
The IUPAC name of (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane (CID 10655668) is (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane.
What is the SMILES notation for (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane?
The canonical SMILES for (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane is C/C=C1\OCCSC1(CC)CCC.
What is the InChIKey of (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane?
The InChIKey is BCNIWDRPCMYUMN-YHYXMXQVSA-N. The full InChI is InChI=1S/C11H20OS/c1-4-7-11(6-3)10(5-2)12-8-9-13-11/h5H,4,6-9H2,1-3H3/b10-5-.
What are the key properties of (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane?
(2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane has a molecular weight of 200.35 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-ethyl-2-ethylidene-3-propyl-1,4-oxathiane is sourced from PubChem (CID 10655668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).