About 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine
1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine (PubChem CID 106556806) has the molecular formula C14H16F3N3O
and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine.
Molecular Properties
| Compound Name | 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine |
| PubChem CID | 106556806 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine |
| SMILES | CCOCCCn1ccnc1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3N3O/c1-2-21-9-3-7-20-8-6-18-14(20)19-11-5-4-10(15)12(16)13(11)17/h4-6,8H,2-3,7,9H2,1H3,(H,18,19) |
| InChIKey | QZYVCCKKPGKZLJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine?
The IUPAC name of 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine (CID 106556806) is 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine.
What is the SMILES notation for 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine?
The canonical SMILES for 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine is CCOCCCn1ccnc1Nc1ccc(F)c(F)c1F.
What is the InChIKey of 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine?
The InChIKey is QZYVCCKKPGKZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3O/c1-2-21-9-3-7-20-8-6-18-14(20)19-11-5-4-10(15)12(16)13(11)17/h4-6,8H,2-3,7,9H2,1H3,(H,18,19).
What are the key properties of 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine?
1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine has a molecular weight of 299.30 g/mol, XLogP of 3.47, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxypropyl)-N-(2,3,4-trifluorophenyl)imidazol-2-amine is sourced from PubChem (CID 106556806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).