C13H15N3 — CID 106557683
N-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazol-2-amine (PubChem CID 106557683) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazol-2-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106557683 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazol-2-amine |
| SMILES | Cn1ccnc1Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H15N3/c1-16-8-7-14-13(16)15-12-6-5-10-3-2-4-11(10)9-12/h5-9H,2-4H2,1H3,(H,14,15) |
| InChIKey | ABSARNRFKMONRS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |