C12H11ClF3N3 — CID 106557968
1-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylimidazol-2-amine (PubChem CID 106557968) has the molecular formula C12H11ClF3N3 and a molecular weight of 289.69 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylimidazol-2-amine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 106557968 |
| Molecular Formula | C12H11ClF3N3 |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylimidazol-2-amine |
| SMILES | CCNc1nccn1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H11ClF3N3/c1-2-17-11-18-5-6-19(11)10-7-8(12(14,15)16)3-4-9(10)13/h3-7H,2H2,1H3,(H,17,18) |
| InChIKey | LFWGJEMCUUWKKA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |