C16H19F2N3 — CID 106558163
1-cyclohexyl-N-(3,4-difluorophenyl)-4-methylimidazol-2-amine (PubChem CID 106558163) has the molecular formula C16H19F2N3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-cyclohexyl-N-(3,4-difluorophenyl)-4-methylimidazol-2-amine.
| Compound Name | 1-cyclohexyl-N-(3,4-difluorophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106558163 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-cyclohexyl-N-(3,4-difluorophenyl)-4-methylimidazol-2-amine |
| SMILES | Cc1cn(C2CCCCC2)c(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H19F2N3/c1-11-10-21(13-5-3-2-4-6-13)16(19-11)20-12-7-8-14(17)15(18)9-12/h7-10,13H,2-6H2,1H3,(H,19,20) |
| InChIKey | WUQUFWDMPXYFNE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |