C10H9F2N3 — CID 106558202
1-(3,4-difluorophenyl)-4-methylimidazol-2-amine (PubChem CID 106558202) has the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-methylimidazol-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106558202 |
| Molecular Formula | C10H9F2N3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-methylimidazol-2-amine |
| SMILES | Cc1cn(-c2ccc(F)c(F)c2)c(N)n1 |
| InChI | InChI=1S/C10H9F2N3/c1-6-5-15(10(13)14-6)7-2-3-8(11)9(12)4-7/h2-5H,1H3,(H2,13,14) |
| InChIKey | NTNGMQBPWAONJY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |