C12H14ClN3O — CID 106558420
N-(3-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-amine (PubChem CID 106558420) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-amine.
| Compound Name | N-(3-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106558420 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-(3-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-amine |
| SMILES | COCCn1ccnc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3O/c1-17-8-7-16-6-5-14-12(16)15-11-4-2-3-10(13)9-11/h2-6,9H,7-8H2,1H3,(H,14,15) |
| InChIKey | BMKJANZENZNGOM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |