About (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione
(4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione (PubChem CID 10655945) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione.
Molecular Properties
| Compound Name | (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione |
| PubChem CID | 10655945 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione |
| SMILES | CN1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NOS/c1-12-10(8-13-11(12)14)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | GIMJMUUWKQZCSY-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione?
The IUPAC name of (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione (CID 10655945) is (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione.
What is the SMILES notation for (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione?
The canonical SMILES for (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione is CN1C(=S)OC[C@@H]1Cc1ccccc1.
What is the InChIKey of (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione?
The InChIKey is GIMJMUUWKQZCSY-JTQLQIEISA-N. The full InChI is InChI=1S/C11H13NOS/c1-12-10(8-13-11(12)14)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1.
What are the key properties of (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione?
(4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione has a molecular weight of 207.30 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-benzyl-3-methyl-1,3-oxazolidine-2-thione is sourced from PubChem (CID 10655945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).