About 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane
4-methylidene-3-(2-methylphenyl)-1,4-oxathiane (PubChem CID 10655989) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane.
Molecular Properties
| Compound Name | 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane |
| PubChem CID | 10655989 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane |
| SMILES | C=S1CCOCC1c1ccccc1C |
| InChI | InChI=1S/C12H16OS/c1-10-5-3-4-6-11(10)12-9-13-7-8-14(12)2/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | GXTRPGVCZMQZAZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane?
The IUPAC name of 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane (CID 10655989) is 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane.
What is the SMILES notation for 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane?
The canonical SMILES for 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane is C=S1CCOCC1c1ccccc1C.
What is the InChIKey of 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane?
The InChIKey is GXTRPGVCZMQZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS/c1-10-5-3-4-6-11(10)12-9-13-7-8-14(12)2/h3-6,12H,2,7-9H2,1H3.
What are the key properties of 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane?
4-methylidene-3-(2-methylphenyl)-1,4-oxathiane has a molecular weight of 208.33 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-3-(2-methylphenyl)-1,4-oxathiane is sourced from PubChem (CID 10655989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).