About N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide
N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide (PubChem CID 10656024) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide |
| PubChem CID | 10656024 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide |
| SMILES | CCC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H23NO/c1-5-13(15)14-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3,(H,14,15)/b12-9+ |
| InChIKey | XEZWYEGQRYWBLW-FMIVXFBMSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide (CID 10656024) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide is CCC(=O)NC/C=C(\C)CCC=C(C)C.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide?
The InChIKey is XEZWYEGQRYWBLW-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-13(15)14-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3,(H,14,15)/b12-9+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide has a molecular weight of 209.33 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]propanamide is sourced from PubChem (CID 10656024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).