C12H18O3 — CID 10656062
[(1R,3aS,7aR)-spiro[1,3,3a,4,7,7a-hexahydroindene-2,2'-1,3-dioxolane]-1-yl]methanol (PubChem CID 10656062) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is [(1R,3aS,7aR)-spiro[1,3,3a,4,7,7a-hexahydroindene-2,2'-1,3-dioxolane]-1-yl]methanol.
| Compound Name | [(1R,3aS,7aR)-spiro[1,3,3a,4,7,7a-hexahydroindene-2,2'-1,3-dioxolane]-1-yl]methanol |
|---|---|
| PubChem CID | 10656062 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | [(1R,3aS,7aR)-spiro[1,3,3a,4,7,7a-hexahydroindene-2,2'-1,3-dioxolane]-1-yl]methanol |
| SMILES | OC[C@H]1[C@@H]2CC=CC[C@H]2CC12OCCO2 |
| InChI | InChI=1S/C12H18O3/c13-8-11-10-4-2-1-3-9(10)7-12(11)14-5-6-15-12/h1-2,9-11,13H,3-8H2/t9-,10+,11-/m0/s1 |
| InChIKey | PFUSXJCMAUVBJN-AXFHLTTASA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|