C12H18O3 — CID 10656064
(1R,2R,5S,6S,7S)-2-hydroxy-5,6-dimethyl-9-oxatricyclo[5.2.2.01,6]undecan-8-one (PubChem CID 10656064) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1R,2R,5S,6S,7S)-2-hydroxy-5,6-dimethyl-9-oxatricyclo[5.2.2.01,6]undecan-8-one.
| Compound Name | (1R,2R,5S,6S,7S)-2-hydroxy-5,6-dimethyl-9-oxatricyclo[5.2.2.01,6]undecan-8-one |
|---|---|
| PubChem CID | 10656064 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1R,2R,5S,6S,7S)-2-hydroxy-5,6-dimethyl-9-oxatricyclo[5.2.2.01,6]undecan-8-one |
| SMILES | C[C@H]1CC[C@@H](O)[C@]23CC[C@H](C(=O)O2)[C@]13C |
| InChI | InChI=1S/C12H18O3/c1-7-3-4-9(13)12-6-5-8(10(14)15-12)11(7,12)2/h7-9,13H,3-6H2,1-2H3/t7-,8+,9+,11-,12-/m0/s1 |
| InChIKey | INZNWRIFLOKNQB-MZQLCRGXSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |