C14H14BrF2N3 — CID 106561364
N-(2-bromo-4,6-difluorophenyl)-1-cyclopentylimidazol-2-amine (PubChem CID 106561364) has the molecular formula C14H14BrF2N3 and a molecular weight of 342.19 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-1-cyclopentylimidazol-2-amine.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-1-cyclopentylimidazol-2-amine |
|---|---|
| PubChem CID | 106561364 |
| Molecular Formula | C14H14BrF2N3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-1-cyclopentylimidazol-2-amine |
| SMILES | Fc1cc(F)c(Nc2nccn2C2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H14BrF2N3/c15-11-7-9(16)8-12(17)13(11)19-14-18-5-6-20(14)10-3-1-2-4-10/h5-8,10H,1-4H2,(H,18,19) |
| InChIKey | NQHWMXGJLIVDDE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |