C9H11N3S — CID 106561413
4-methyl-1-(thiophen-2-ylmethyl)imidazol-2-amine (PubChem CID 106561413) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 4-methyl-1-(thiophen-2-ylmethyl)imidazol-2-amine.
| Compound Name | 4-methyl-1-(thiophen-2-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106561413 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-methyl-1-(thiophen-2-ylmethyl)imidazol-2-amine |
| SMILES | Cc1cn(Cc2cccs2)c(N)n1 |
| InChI | InChI=1S/C9H11N3S/c1-7-5-12(9(10)11-7)6-8-3-2-4-13-8/h2-5H,6H2,1H3,(H2,10,11) |
| InChIKey | VAHYXWQVYJZZAK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |