About ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate
ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate (PubChem CID 10656171) has the molecular formula C8H14F2O2S
and a molecular weight of 212.26 g/mol. Its IUPAC name is ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate |
| PubChem CID | 10656171 |
| Molecular Formula | C8H14F2O2S |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)SC(C)(C)C |
| InChI | InChI=1S/C8H14F2O2S/c1-5-12-6(11)8(9,10)13-7(2,3)4/h5H2,1-4H3 |
| InChIKey | HZYLLMNYPFYUDF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate?
The IUPAC name of ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate (CID 10656171) is ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate is CCOC(=O)C(F)(F)SC(C)(C)C.
What is the InChIKey of ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate?
The InChIKey is HZYLLMNYPFYUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2O2S/c1-5-12-6(11)8(9,10)13-7(2,3)4/h5H2,1-4H3.
What are the key properties of ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate?
ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate has a molecular weight of 212.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-tert-butylsulfanyl-2,2-difluoroacetate is sourced from PubChem (CID 10656171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).