About 8-bromo-2,3-dihydro-1H-indolizin-5-one
8-bromo-2,3-dihydro-1H-indolizin-5-one (PubChem CID 10656240) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is 8-bromo-2,3-dihydro-1H-indolizin-5-one.
Molecular Properties
| Compound Name | 8-bromo-2,3-dihydro-1H-indolizin-5-one |
| PubChem CID | 10656240 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 8-bromo-2,3-dihydro-1H-indolizin-5-one |
| SMILES | O=c1ccc(Br)c2n1CCC2 |
| InChI | InChI=1S/C8H8BrNO/c9-6-3-4-8(11)10-5-1-2-7(6)10/h3-4H,1-2,5H2 |
| InChIKey | OGDBKUKFROETQZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2,3-dihydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,3-dihydro-1H-indolizin-5-one?
The IUPAC name of 8-bromo-2,3-dihydro-1H-indolizin-5-one (CID 10656240) is 8-bromo-2,3-dihydro-1H-indolizin-5-one.
What is the SMILES notation for 8-bromo-2,3-dihydro-1H-indolizin-5-one?
The canonical SMILES for 8-bromo-2,3-dihydro-1H-indolizin-5-one is O=c1ccc(Br)c2n1CCC2.
What is the InChIKey of 8-bromo-2,3-dihydro-1H-indolizin-5-one?
The InChIKey is OGDBKUKFROETQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO/c9-6-3-4-8(11)10-5-1-2-7(6)10/h3-4H,1-2,5H2.
What are the key properties of 8-bromo-2,3-dihydro-1H-indolizin-5-one?
8-bromo-2,3-dihydro-1H-indolizin-5-one has a molecular weight of 214.06 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,3-dihydro-1H-indolizin-5-one is sourced from PubChem (CID 10656240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).