C12H19N3O2S — CID 106562577
1-(1,1-dioxothian-4-yl)-4-methyl-N-prop-2-enylimidazol-2-amine (PubChem CID 106562577) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-4-methyl-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)-4-methyl-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106562577 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-4-methyl-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nc(C)cn1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19N3O2S/c1-3-6-13-12-14-10(2)9-15(12)11-4-7-18(16,17)8-5-11/h3,9,11H,1,4-8H2,2H3,(H,13,14) |
| InChIKey | XPFROZTXHIGOAT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|