C11H22SSi — CID 10656293
trimethyl-(3,4,6-trimethyl-2,5-dihydrothiopyran-6-yl)silane (PubChem CID 10656293) has the molecular formula C11H22SSi and a molecular weight of 214.45 g/mol. Its IUPAC name is trimethyl-(3,4,6-trimethyl-2,5-dihydrothiopyran-6-yl)silane.
| Compound Name | trimethyl-(3,4,6-trimethyl-2,5-dihydrothiopyran-6-yl)silane |
|---|---|
| PubChem CID | 10656293 |
| Molecular Formula | C11H22SSi |
| Molecular Weight | 214.45 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | trimethyl-(3,4,6-trimethyl-2,5-dihydrothiopyran-6-yl)silane |
| SMILES | CC1=C(C)CC(C)([Si](C)(C)C)SC1 |
| InChI | InChI=1S/C11H22SSi/c1-9-7-11(3,13(4,5)6)12-8-10(9)2/h7-8H2,1-6H3 |
| InChIKey | VIRNKXAOGPTZLW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|