C12H20N4 — CID 106563055
1-[(1-methylpyrrolidin-3-yl)methyl]-N-prop-2-enylimidazol-2-amine (PubChem CID 106563055) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-[(1-methylpyrrolidin-3-yl)methyl]-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106563055 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1CC1CCN(C)C1 |
| InChI | InChI=1S/C12H20N4/c1-3-5-13-12-14-6-8-16(12)10-11-4-7-15(2)9-11/h3,6,8,11H,1,4-5,7,9-10H2,2H3,(H,13,14) |
| InChIKey | MWJXRQURQCRBGN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|