C16H23N5 — CID 106564203
1-cyclohexyl-4-methyl-N-[(2-methylpyrimidin-4-yl)methyl]imidazol-2-amine (PubChem CID 106564203) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-cyclohexyl-4-methyl-N-[(2-methylpyrimidin-4-yl)methyl]imidazol-2-amine.
| Compound Name | 1-cyclohexyl-4-methyl-N-[(2-methylpyrimidin-4-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106564203 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-cyclohexyl-4-methyl-N-[(2-methylpyrimidin-4-yl)methyl]imidazol-2-amine |
| SMILES | Cc1cn(C2CCCCC2)c(NCc2ccnc(C)n2)n1 |
| InChI | InChI=1S/C16H23N5/c1-12-11-21(15-6-4-3-5-7-15)16(19-12)18-10-14-8-9-17-13(2)20-14/h8-9,11,15H,3-7,10H2,1-2H3,(H,18,19) |
| InChIKey | FQNWFRIXUXXEKD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |