C13H17NO2 — CID 10656503
3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]pyridine (PubChem CID 10656503) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]pyridine.
| Compound Name | 3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]pyridine |
|---|---|
| PubChem CID | 10656503 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]pyridine |
| SMILES | C=C[C@@H]1COC(C)(C)O[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C13H17NO2/c1-4-10-9-15-13(2,3)16-12(10)11-6-5-7-14-8-11/h4-8,10,12H,1,9H2,2-3H3/t10-,12+/m1/s1 |
| InChIKey | PSMWIYZDYSEGBI-PWSUYJOCSA-N |
| XLogP | 2.71 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|