C14H26N4 — CID 106565060
1-(2-methylpropyl)-N-(2-piperidin-1-ylethyl)imidazol-2-amine (PubChem CID 106565060) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-(2-methylpropyl)-N-(2-piperidin-1-ylethyl)imidazol-2-amine.
| Compound Name | 1-(2-methylpropyl)-N-(2-piperidin-1-ylethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106565060 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 1-(2-methylpropyl)-N-(2-piperidin-1-ylethyl)imidazol-2-amine |
| SMILES | CC(C)Cn1ccnc1NCCN1CCCCC1 |
| InChI | InChI=1S/C14H26N4/c1-13(2)12-18-11-7-16-14(18)15-6-10-17-8-4-3-5-9-17/h7,11,13H,3-6,8-10,12H2,1-2H3,(H,15,16) |
| InChIKey | ONFCMLWHHTZJGH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |