C9H16O6 — CID 10656525
3-[5-(1,2,4-trioxolan-3-yl)pentyl]-1,2,4-trioxolane (PubChem CID 10656525) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-[5-(1,2,4-trioxolan-3-yl)pentyl]-1,2,4-trioxolane.
| Compound Name | 3-[5-(1,2,4-trioxolan-3-yl)pentyl]-1,2,4-trioxolane |
|---|---|
| PubChem CID | 10656525 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-[5-(1,2,4-trioxolan-3-yl)pentyl]-1,2,4-trioxolane |
| SMILES | C(CCC1OCOO1)CCC1OCOO1 |
| InChI | InChI=1S/C9H16O6/c1(2-4-8-10-6-12-14-8)3-5-9-11-7-13-15-9/h8-9H,1-7H2 |
| InChIKey | QEZOIXBPRBMRQE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|