C13H24N4 — CID 106565561
1-[4-(dimethylamino)butyl]-4-methyl-N-prop-2-enylimidazol-2-amine (PubChem CID 106565561) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[4-(dimethylamino)butyl]-4-methyl-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-[4-(dimethylamino)butyl]-4-methyl-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106565561 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-[4-(dimethylamino)butyl]-4-methyl-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nc(C)cn1CCCCN(C)C |
| InChI | InChI=1S/C13H24N4/c1-5-8-14-13-15-12(2)11-17(13)10-7-6-9-16(3)4/h5,11H,1,6-10H2,2-4H3,(H,14,15) |
| InChIKey | CLHRLKBPRHMBFW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|