C13H20N4OS — CID 106565661
N-(3-ethoxypropyl)-4-methyl-1-(1,3-thiazol-2-ylmethyl)imidazol-2-amine (PubChem CID 106565661) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-methyl-1-(1,3-thiazol-2-ylmethyl)imidazol-2-amine.
| Compound Name | N-(3-ethoxypropyl)-4-methyl-1-(1,3-thiazol-2-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106565661 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(3-ethoxypropyl)-4-methyl-1-(1,3-thiazol-2-ylmethyl)imidazol-2-amine |
| SMILES | CCOCCCNc1nc(C)cn1Cc1nccs1 |
| InChI | InChI=1S/C13H20N4OS/c1-3-18-7-4-5-15-13-16-11(2)9-17(13)10-12-14-6-8-19-12/h6,8-9H,3-5,7,10H2,1-2H3,(H,15,16) |
| InChIKey | KZQNPUKEDADQIX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|