C13H20N2O — CID 10656568
5-(butylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 10656568) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-(butylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(butylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10656568 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-(butylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CCCCNC1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C13H20N2O/c1-2-3-9-14-11-5-4-6-12-10(11)7-8-13(16)15-12/h7-8,11,14H,2-6,9H2,1H3,(H,15,16) |
| InChIKey | FVGCWHKHUYQKMI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|