2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid

C9H19NO5 — CID 10656594

IUPAC2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid
SMILESCOCCOCCOCCNCC(=O)O
InChIInChI=1S/C9H19NO5/c1-13-4-5-15-7-6-14-3-2-10-8-9(11)12/h10H,2-8H2,1H3,(H,11,12)
InChIKeyHJQXOYZSPYHFOA-UHFFFAOYSA-N
MW221.25 g/mol
LogP-0.66
Rot. Bonds11

About 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid

2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid (PubChem CID 10656594) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid
PubChem CID10656594
Molecular FormulaC9H19NO5
Molecular Weight221.25 g/mol
Exact Mass221.13
IUPAC Name2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid
SMILESCOCCOCCOCCNCC(=O)O
InChIInChI=1S/C9H19NO5/c1-13-4-5-15-7-6-14-3-2-10-8-9(11)12/h10H,2-8H2,1H3,(H,11,12)
InChIKeyHJQXOYZSPYHFOA-UHFFFAOYSA-N
XLogP-0.66
TPSA77.02 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.25
LogP ≤ 5-0.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid?
The IUPAC name of 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid (CID 10656594) is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid.
What is the SMILES notation for 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid?
The canonical SMILES for 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid is COCCOCCOCCNCC(=O)O.
What is the InChIKey of 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid?
The InChIKey is HJQXOYZSPYHFOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO5/c1-13-4-5-15-7-6-14-3-2-10-8-9(11)12/h10H,2-8H2,1H3,(H,11,12).
What are the key properties of 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid?
2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid has a molecular weight of 221.25 g/mol, XLogP of -0.66, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]acetic acid is sourced from PubChem (CID 10656594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).