C9H12F2O4 — CID 10656629
methyl (4S)-4-acetyloxy-5,5-difluoro-2-methylidenepentanoate (PubChem CID 10656629) has the molecular formula C9H12F2O4 and a molecular weight of 222.19 g/mol. Its IUPAC name is methyl (4S)-4-acetyloxy-5,5-difluoro-2-methylidenepentanoate.
| Compound Name | methyl (4S)-4-acetyloxy-5,5-difluoro-2-methylidenepentanoate |
|---|---|
| PubChem CID | 10656629 |
| Molecular Formula | C9H12F2O4 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | methyl (4S)-4-acetyloxy-5,5-difluoro-2-methylidenepentanoate |
| SMILES | C=C(C[C@H](OC(C)=O)C(F)F)C(=O)OC |
| InChI | InChI=1S/C9H12F2O4/c1-5(9(13)14-3)4-7(8(10)11)15-6(2)12/h7-8H,1,4H2,2-3H3/t7-/m0/s1 |
| InChIKey | QCMMMCAHPTWGDR-ZETCQYMHSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|