About 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine
1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine (PubChem CID 106566619) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine |
| PubChem CID | 106566619 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine |
| SMILES | Cc1nc(C)c(C(C)Nc2nccn2C2CCCC2)s1 |
| InChI | InChI=1S/C15H22N4S/c1-10-14(20-12(3)17-10)11(2)18-15-16-8-9-19(15)13-6-4-5-7-13/h8-9,11,13H,4-7H2,1-3H3,(H,16,18) |
| InChIKey | AXXBCKHENKXALW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine?
The IUPAC name of 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine (CID 106566619) is 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine.
What is the SMILES notation for 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine?
The canonical SMILES for 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine is Cc1nc(C)c(C(C)Nc2nccn2C2CCCC2)s1.
What is the InChIKey of 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine?
The InChIKey is AXXBCKHENKXALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4S/c1-10-14(20-12(3)17-10)11(2)18-15-16-8-9-19(15)13-6-4-5-7-13/h8-9,11,13H,4-7H2,1-3H3,(H,16,18).
What are the key properties of 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine?
1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine has a molecular weight of 290.44 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]imidazol-2-amine is sourced from PubChem (CID 106566619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).