C10H12N4S — CID 10656720
5,5,9-trideuterio-2-methylsulfanyl-7,8-dihydro-6H-[1,2,4]triazolo[5,1-b]quinazoline (PubChem CID 10656720) has the molecular formula C10H12N4S and a molecular weight of 223.32 g/mol. Its IUPAC name is 5,5,9-trideuterio-2-methylsulfanyl-7,8-dihydro-6H-[1,2,4]triazolo[5,1-b]quinazoline.
| Compound Name | 5,5,9-trideuterio-2-methylsulfanyl-7,8-dihydro-6H-[1,2,4]triazolo[5,1-b]quinazoline |
|---|---|
| PubChem CID | 10656720 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5,5,9-trideuterio-2-methylsulfanyl-7,8-dihydro-6H-[1,2,4]triazolo[5,1-b]quinazoline |
| SMILES | [2H]c1c2c(nc3nc(SC)nn13)C([2H])([2H])CCC2 |
| InChI | InChI=1S/C10H12N4S/c1-15-10-12-9-11-8-5-3-2-4-7(8)6-14(9)13-10/h6H,2-5H2,1H3/i5D2,6D |
| InChIKey | IKFFVVREOGXQEY-JQCZWRKMSA-N |
| XLogP | 1.73 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |