C16H23N3 — CID 106567389
1-butyl-N-(2-propylphenyl)imidazol-2-amine (PubChem CID 106567389) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-butyl-N-(2-propylphenyl)imidazol-2-amine.
| Compound Name | 1-butyl-N-(2-propylphenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106567389 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-butyl-N-(2-propylphenyl)imidazol-2-amine |
| SMILES | CCCCn1ccnc1Nc1ccccc1CCC |
| InChI | InChI=1S/C16H23N3/c1-3-5-12-19-13-11-17-16(19)18-15-10-7-6-9-14(15)8-4-2/h6-7,9-11,13H,3-5,8,12H2,1-2H3,(H,17,18) |
| InChIKey | DBDPDLYPSPOIQM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |